C18H18FN3O3 — CID 120744194
[(3R,4R)-3-(aminomethyl)-4-phenylpyrrolidin-1-yl]-(2-fluoro-4-nitrophenyl)methanone (PubChem CID 120744194) has the molecular formula C18H18FN3O3 and a molecular weight of 343.36 g/mol. Its IUPAC name is [(3R,4R)-3-(aminomethyl)-4-phenylpyrrolidin-1-yl]-(2-fluoro-4-nitrophenyl)methanone.
| Compound Name | [(3R,4R)-3-(aminomethyl)-4-phenylpyrrolidin-1-yl]-(2-fluoro-4-nitrophenyl)methanone |
|---|---|
| PubChem CID | 120744194 |
| Molecular Formula | C18H18FN3O3 |
| Molecular Weight | 343.36 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | [(3R,4R)-3-(aminomethyl)-4-phenylpyrrolidin-1-yl]-(2-fluoro-4-nitrophenyl)methanone |
| SMILES | NC[C@@H]1CN(C(=O)c2ccc([N+](=O)[O-])cc2F)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C18H18FN3O3/c19-17-8-14(22(24)25)6-7-15(17)18(23)21-10-13(9-20)16(11-21)12-4-2-1-3-5-12/h1-8,13,16H,9-11,20H2/t13-,16+/m1/s1 |
| InChIKey | HMQUVUBWKSUIJX-CJNGLKHVSA-N |
| XLogP | 2.55 |
| TPSA | 89.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.36 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|