C18H17Cl2FN2O — CID 120742649
[(3R,4R)-3-(aminomethyl)-4-phenylpyrrolidin-1-yl]-(2,4-dichloro-5-fluorophenyl)methanone (PubChem CID 120742649) has the molecular formula C18H17Cl2FN2O and a molecular weight of 367.25 g/mol. Its IUPAC name is [(3R,4R)-3-(aminomethyl)-4-phenylpyrrolidin-1-yl]-(2,4-dichloro-5-fluorophenyl)methanone.
| Compound Name | [(3R,4R)-3-(aminomethyl)-4-phenylpyrrolidin-1-yl]-(2,4-dichloro-5-fluorophenyl)methanone |
|---|---|
| PubChem CID | 120742649 |
| Molecular Formula | C18H17Cl2FN2O |
| Molecular Weight | 367.25 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | [(3R,4R)-3-(aminomethyl)-4-phenylpyrrolidin-1-yl]-(2,4-dichloro-5-fluorophenyl)methanone |
| SMILES | NC[C@@H]1CN(C(=O)c2cc(F)c(Cl)cc2Cl)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C18H17Cl2FN2O/c19-15-7-16(20)17(21)6-13(15)18(24)23-9-12(8-22)14(10-23)11-4-2-1-3-5-11/h1-7,12,14H,8-10,22H2/t12-,14+/m1/s1 |
| InChIKey | RQDDURUWGALZCS-OCCSQVGLSA-N |
| XLogP | 3.95 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.25 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|