C19H20FN3O3 — CID 120742357
[(3R,4R)-3-(aminomethyl)-4-phenylpyrrolidin-1-yl]-(5-fluoro-3-methyl-2-nitrophenyl)methanone (PubChem CID 120742357) has the molecular formula C19H20FN3O3 and a molecular weight of 357.39 g/mol. Its IUPAC name is [(3R,4R)-3-(aminomethyl)-4-phenylpyrrolidin-1-yl]-(5-fluoro-3-methyl-2-nitrophenyl)methanone.
| Compound Name | [(3R,4R)-3-(aminomethyl)-4-phenylpyrrolidin-1-yl]-(5-fluoro-3-methyl-2-nitrophenyl)methanone |
|---|---|
| PubChem CID | 120742357 |
| Molecular Formula | C19H20FN3O3 |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | [(3R,4R)-3-(aminomethyl)-4-phenylpyrrolidin-1-yl]-(5-fluoro-3-methyl-2-nitrophenyl)methanone |
| SMILES | Cc1cc(F)cc(C(=O)N2C[C@@H](CN)[C@H](c3ccccc3)C2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C19H20FN3O3/c1-12-7-15(20)8-16(18(12)23(25)26)19(24)22-10-14(9-21)17(11-22)13-5-3-2-4-6-13/h2-8,14,17H,9-11,21H2,1H3/t14-,17+/m1/s1 |
| InChIKey | URQMTJLVYDDCPI-PBHICJAKSA-N |
| XLogP | 2.86 |
| TPSA | 89.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|