C17H20ClN3O3S — CID 120744703
[(3R,4R)-3-(aminomethyl)-4-phenylpyrrolidin-1-yl]-(5-methyl-4-nitrothiophen-2-yl)methanone;hydrochloride (PubChem CID 120744703) has the molecular formula C17H20ClN3O3S and a molecular weight of 381.89 g/mol. Its IUPAC name is [(3R,4R)-3-(aminomethyl)-4-phenylpyrrolidin-1-yl]-(5-methyl-4-nitrothiophen-2-yl)methanone;hydrochloride.
| Compound Name | [(3R,4R)-3-(aminomethyl)-4-phenylpyrrolidin-1-yl]-(5-methyl-4-nitrothiophen-2-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 120744703 |
| Molecular Formula | C17H20ClN3O3S |
| Molecular Weight | 381.89 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | [(3R,4R)-3-(aminomethyl)-4-phenylpyrrolidin-1-yl]-(5-methyl-4-nitrothiophen-2-yl)methanone;hydrochloride |
| SMILES | Cc1sc(C(=O)N2C[C@@H](CN)[C@H](c3ccccc3)C2)cc1[N+](=O)[O-].Cl |
| InChI | InChI=1S/C17H19N3O3S.ClH/c1-11-15(20(22)23)7-16(24-11)17(21)19-9-13(8-18)14(10-19)12-5-3-2-4-6-12;/h2-7,13-14H,8-10,18H2,1H3;1H/t13-,14+;/m1./s1 |
| InChIKey | KKLPRAUWRNCEDF-DFQHDRSWSA-N |
| XLogP | 3.20 |
| TPSA | 89.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.89 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|