C19H20ClN5O3 — CID 120743019
[(3R,4R)-3-(aminomethyl)-4-phenylpyrrolidin-1-yl]-(5-nitro-1H-indazol-3-yl)methanone;hydrochloride (PubChem CID 120743019) has the molecular formula C19H20ClN5O3 and a molecular weight of 401.85 g/mol. Its IUPAC name is [(3R,4R)-3-(aminomethyl)-4-phenylpyrrolidin-1-yl]-(5-nitro-1H-indazol-3-yl)methanone;hydrochloride.
| Compound Name | [(3R,4R)-3-(aminomethyl)-4-phenylpyrrolidin-1-yl]-(5-nitro-1H-indazol-3-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 120743019 |
| Molecular Formula | C19H20ClN5O3 |
| Molecular Weight | 401.85 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | [(3R,4R)-3-(aminomethyl)-4-phenylpyrrolidin-1-yl]-(5-nitro-1H-indazol-3-yl)methanone;hydrochloride |
| SMILES | Cl.NC[C@@H]1CN(C(=O)c2n[nH]c3ccc([N+](=O)[O-])cc23)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C19H19N5O3.ClH/c20-9-13-10-23(11-16(13)12-4-2-1-3-5-12)19(25)18-15-8-14(24(26)27)6-7-17(15)21-22-18;/h1-8,13,16H,9-11,20H2,(H,21,22);1H/t13-,16+;/m1./s1 |
| InChIKey | HTRRDYDCEUVGFR-CACIRBSMSA-N |
| XLogP | 2.71 |
| TPSA | 118.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.85 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|