C35H44N2O7Si — CID 46178143
[(1S,5R,6R,7R,8R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,7-bis(phenylmethoxy)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl] 4-nitrobenzoate (PubChem CID 46178143) has the molecular formula C35H44N2O7Si and a molecular weight of 632.83 g/mol. Its IUPAC name is [(1S,5R,6R,7R,8R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,7-bis(phenylmethoxy)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl] 4-nitrobenzoate.
| Compound Name | [(1S,5R,6R,7R,8R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,7-bis(phenylmethoxy)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 46178143 |
| Molecular Formula | C35H44N2O7Si |
| Molecular Weight | 632.83 g/mol |
| Exact Mass | 632.29 |
| IUPAC Name | [(1S,5R,6R,7R,8R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,7-bis(phenylmethoxy)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl] 4-nitrobenzoate |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]2[C@@H](OC(=O)c3ccc([N+](=O)[O-])cc3)CCN21 |
| InChI | InChI=1S/C35H44N2O7Si/c1-35(2,3)45(4,5)43-24-29-32(41-22-25-12-8-6-9-13-25)33(42-23-26-14-10-7-11-15-26)31-30(20-21-36(29)31)44-34(38)27-16-18-28(19-17-27)37(39)40/h6-19,29-33H,20-24H2,1-5H3/t29-,30+,31-,32-,33-/m1/s1 |
| InChIKey | PSPDRWBOYDRXJV-CVCQUZQZSA-N |
| XLogP | 6.77 |
| TPSA | 100.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.83 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|