C29H33NO6Si — CID 158369010
[(2R,3S,4R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-methyloxolan-3-yl] 4-nitrobenzoate (PubChem CID 158369010) has the molecular formula C29H33NO6Si and a molecular weight of 519.67 g/mol. Its IUPAC name is [(2R,3S,4R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-methyloxolan-3-yl] 4-nitrobenzoate.
| Compound Name | [(2R,3S,4R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-methyloxolan-3-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 158369010 |
| Molecular Formula | C29H33NO6Si |
| Molecular Weight | 519.67 g/mol |
| Exact Mass | 519.21 |
| IUPAC Name | [(2R,3S,4R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-methyloxolan-3-yl] 4-nitrobenzoate |
| SMILES | C[C@@H]1CO[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H]1OC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C29H33NO6Si/c1-21-19-34-26(27(21)36-28(31)22-15-17-23(18-16-22)30(32)33)20-35-37(29(2,3)4,24-11-7-5-8-12-24)25-13-9-6-10-14-25/h5-18,21,26-27H,19-20H2,1-4H3/t21-,26-,27+/m1/s1 |
| InChIKey | ZPWURNGNMSTLPD-ZFWHIUCFSA-N |
| XLogP | 4.73 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.67 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|