C28H34N2O7Si — CID 168866630
(2R,3R,4R,5R,6R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-(4-nitroanilino)oxane-3,4,5-triol (PubChem CID 168866630) has the molecular formula C28H34N2O7Si and a molecular weight of 538.67 g/mol. Its IUPAC name is (2R,3R,4R,5R,6R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-(4-nitroanilino)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4R,5R,6R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-(4-nitroanilino)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 168866630 |
| Molecular Formula | C28H34N2O7Si |
| Molecular Weight | 538.67 g/mol |
| Exact Mass | 538.21 |
| IUPAC Name | (2R,3R,4R,5R,6R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-(4-nitroanilino)oxane-3,4,5-triol |
| SMILES | CC(C)(C)[Si](OC[C@H]1O[C@@H](Nc2ccc([N+](=O)[O-])cc2)[C@H](O)[C@H](O)[C@H]1O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H34N2O7Si/c1-28(2,3)38(21-10-6-4-7-11-21,22-12-8-5-9-13-22)36-18-23-24(31)25(32)26(33)27(37-23)29-19-14-16-20(17-15-19)30(34)35/h4-17,23-27,29,31-33H,18H2,1-3H3/t23-,24+,25-,26-,27-/m1/s1 |
| InChIKey | DUFQSLKFPKEAEH-UDLFFNGBSA-N |
| XLogP | 2.39 |
| TPSA | 134.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.67 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|