C25H26N2O5Si — CID 170748803
2-[[tert-butyl(diphenyl)silyl]oxymethyl]-7-nitro-4H-1,4-benzoxazin-3-one (PubChem CID 170748803) has the molecular formula C25H26N2O5Si and a molecular weight of 462.58 g/mol. Its IUPAC name is 2-[[tert-butyl(diphenyl)silyl]oxymethyl]-7-nitro-4H-1,4-benzoxazin-3-one.
| Compound Name | 2-[[tert-butyl(diphenyl)silyl]oxymethyl]-7-nitro-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 170748803 |
| Molecular Formula | C25H26N2O5Si |
| Molecular Weight | 462.58 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | 2-[[tert-butyl(diphenyl)silyl]oxymethyl]-7-nitro-4H-1,4-benzoxazin-3-one |
| SMILES | CC(C)(C)[Si](OCC1Oc2cc([N+](=O)[O-])ccc2NC1=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H26N2O5Si/c1-25(2,3)33(19-10-6-4-7-11-19,20-12-8-5-9-13-20)31-17-23-24(28)26-21-15-14-18(27(29)30)16-22(21)32-23/h4-16,23H,17H2,1-3H3,(H,26,28) |
| InChIKey | RROJJWBVSMNIEZ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.58 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|