C27H28N2O3Si — CID 155726358
N-[[2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-nitrophenyl]methyl]prop-2-yn-1-imine (PubChem CID 155726358) has the molecular formula C27H28N2O3Si and a molecular weight of 456.62 g/mol. Its IUPAC name is N-[[2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-nitrophenyl]methyl]prop-2-yn-1-imine.
| Compound Name | N-[[2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-nitrophenyl]methyl]prop-2-yn-1-imine |
|---|---|
| PubChem CID | 155726358 |
| Molecular Formula | C27H28N2O3Si |
| Molecular Weight | 456.62 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | N-[[2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-nitrophenyl]methyl]prop-2-yn-1-imine |
| SMILES | C#C/C=N/Cc1cc([N+](=O)[O-])ccc1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C27H28N2O3Si/c1-5-18-28-20-23-19-24(29(30)31)17-16-22(23)21-32-33(27(2,3)4,25-12-8-6-9-13-25)26-14-10-7-11-15-26/h1,6-19H,20-21H2,2-4H3/b28-18+ |
| InChIKey | SZWFIQRPKLADCJ-MTDXEUNCSA-N |
| XLogP | 4.88 |
| TPSA | 64.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.62 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|