C25H26INO3Si — CID 10506695
2-[2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxy-5-iodophenoxy]acetonitrile (PubChem CID 10506695) has the molecular formula C25H26INO3Si and a molecular weight of 543.48 g/mol. Its IUPAC name is 2-[2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxy-5-iodophenoxy]acetonitrile.
| Compound Name | 2-[2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxy-5-iodophenoxy]acetonitrile |
|---|---|
| PubChem CID | 10506695 |
| Molecular Formula | C25H26INO3Si |
| Molecular Weight | 543.48 g/mol |
| Exact Mass | 543.07 |
| IUPAC Name | 2-[2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxy-5-iodophenoxy]acetonitrile |
| SMILES | CC(C)(C)[Si](OCc1cc(O)c(I)cc1OCC#N)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H26INO3Si/c1-25(2,3)31(20-10-6-4-7-11-20,21-12-8-5-9-13-21)30-18-19-16-23(28)22(26)17-24(19)29-15-14-27/h4-13,16-17,28H,15,18H2,1-3H3 |
| InChIKey | PVKFBNNSHLWTEM-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 62.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.48 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|