C45H45IO5Si — CID 10843132
5-[[3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-methoxy-5-phenylmethoxyphenyl]methyl]-2-iodo-4-phenylmethoxyphenol (PubChem CID 10843132) has the molecular formula C45H45IO5Si and a molecular weight of 820.84 g/mol. Its IUPAC name is 5-[[3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-methoxy-5-phenylmethoxyphenyl]methyl]-2-iodo-4-phenylmethoxyphenol.
| Compound Name | 5-[[3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-methoxy-5-phenylmethoxyphenyl]methyl]-2-iodo-4-phenylmethoxyphenol |
|---|---|
| PubChem CID | 10843132 |
| Molecular Formula | C45H45IO5Si |
| Molecular Weight | 820.84 g/mol |
| Exact Mass | 820.21 |
| IUPAC Name | 5-[[3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-methoxy-5-phenylmethoxyphenyl]methyl]-2-iodo-4-phenylmethoxyphenol |
| SMILES | COc1c(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cc(OCc2ccccc2)cc1Cc1cc(O)c(I)cc1OCc1ccccc1 |
| InChI | InChI=1S/C45H45IO5Si/c1-45(2,3)52(39-21-13-7-14-22-39,40-23-15-8-16-24-40)51-32-37-27-38(49-30-33-17-9-5-10-18-33)26-36(44(37)48-4)25-35-28-42(47)41(46)29-43(35)50-31-34-19-11-6-12-20-34/h5-24,26-29,47H,25,30-32H2,1-4H3 |
| InChIKey | ZAHKLMLDRJDIKQ-UHFFFAOYSA-N |
| XLogP | 9.83 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.84 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|