C44H44O4Si — CID 10842123
1-[3-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-phenyl-6-phenylmethoxynaphthalen-2-yl]ethyl acetate (PubChem CID 10842123) has the molecular formula C44H44O4Si and a molecular weight of 664.92 g/mol. Its IUPAC name is 1-[3-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-phenyl-6-phenylmethoxynaphthalen-2-yl]ethyl acetate.
| Compound Name | 1-[3-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-phenyl-6-phenylmethoxynaphthalen-2-yl]ethyl acetate |
|---|---|
| PubChem CID | 10842123 |
| Molecular Formula | C44H44O4Si |
| Molecular Weight | 664.92 g/mol |
| Exact Mass | 664.30 |
| IUPAC Name | 1-[3-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-phenyl-6-phenylmethoxynaphthalen-2-yl]ethyl acetate |
| SMILES | CC(=O)OC(C)c1c(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cc2cc(OCc3ccccc3)ccc2c1-c1ccccc1 |
| InChI | InChI=1S/C44H44O4Si/c1-32(48-33(2)45)42-37(31-47-49(44(3,4)5,39-22-14-8-15-23-39)40-24-16-9-17-25-40)28-36-29-38(46-30-34-18-10-6-11-19-34)26-27-41(36)43(42)35-20-12-7-13-21-35/h6-29,32H,30-31H2,1-5H3 |
| InChIKey | MEZSXKJHYGXYJJ-UHFFFAOYSA-N |
| XLogP | 9.79 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.92 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|