C32H40O5Si — CID 101059127
[(E,3R)-1-[4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,6-dimethoxyphenyl]pent-1-en-3-yl] acetate (PubChem CID 101059127) has the molecular formula C32H40O5Si and a molecular weight of 532.75 g/mol. Its IUPAC name is [(E,3R)-1-[4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,6-dimethoxyphenyl]pent-1-en-3-yl] acetate.
| Compound Name | [(E,3R)-1-[4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,6-dimethoxyphenyl]pent-1-en-3-yl] acetate |
|---|---|
| PubChem CID | 101059127 |
| Molecular Formula | C32H40O5Si |
| Molecular Weight | 532.75 g/mol |
| Exact Mass | 532.26 |
| IUPAC Name | [(E,3R)-1-[4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,6-dimethoxyphenyl]pent-1-en-3-yl] acetate |
| SMILES | CC[C@H](/C=C/c1c(OC)cc(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cc1OC)OC(C)=O |
| InChI | InChI=1S/C32H40O5Si/c1-8-26(37-24(2)33)19-20-29-30(34-6)21-25(22-31(29)35-7)23-36-38(32(3,4)5,27-15-11-9-12-16-27)28-17-13-10-14-18-28/h9-22,26H,8,23H2,1-7H3/b20-19+/t26-/m1/s1 |
| InChIKey | DFEOAWSAYYJRIV-MYXIRXPSSA-N |
| XLogP | 6.14 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.75 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|