C34H39NO5Si — CID 70073946
(2S)-2-[4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,6-dimethoxyanilino]-3-phenylpropanoic acid (PubChem CID 70073946) has the molecular formula C34H39NO5Si and a molecular weight of 569.77 g/mol. Its IUPAC name is (2S)-2-[4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,6-dimethoxyanilino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,6-dimethoxyanilino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 70073946 |
| Molecular Formula | C34H39NO5Si |
| Molecular Weight | 569.77 g/mol |
| Exact Mass | 569.26 |
| IUPAC Name | (2S)-2-[4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,6-dimethoxyanilino]-3-phenylpropanoic acid |
| SMILES | COc1cc(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cc(OC)c1N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C34H39NO5Si/c1-34(2,3)41(27-17-11-7-12-18-27,28-19-13-8-14-20-28)40-24-26-22-30(38-4)32(31(23-26)39-5)35-29(33(36)37)21-25-15-9-6-10-16-25/h6-20,22-23,29,35H,21,24H2,1-5H3,(H,36,37)/t29-/m0/s1 |
| InChIKey | AZIRWMRAISJENH-LJAQVGFWSA-N |
| XLogP | 5.89 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.77 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|