C16H19N3O3 — CID 122049534
(2S)-2-[[2-(methoxymethyl)-6-methylpyrimidin-4-yl]amino]-3-phenylpropanoic acid (PubChem CID 122049534) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is (2S)-2-[[2-(methoxymethyl)-6-methylpyrimidin-4-yl]amino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[[2-(methoxymethyl)-6-methylpyrimidin-4-yl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 122049534 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | (2S)-2-[[2-(methoxymethyl)-6-methylpyrimidin-4-yl]amino]-3-phenylpropanoic acid |
| SMILES | COCc1nc(C)cc(N[C@@H](Cc2ccccc2)C(=O)O)n1 |
| InChI | InChI=1S/C16H19N3O3/c1-11-8-14(19-15(17-11)10-22-2)18-13(16(20)21)9-12-6-4-3-5-7-12/h3-8,13H,9-10H2,1-2H3,(H,20,21)(H,17,18,19)/t13-/m0/s1 |
| InChIKey | GNCRHQFKWGHNHV-ZDUSSCGKSA-N |
| XLogP | 2.04 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |