C45H59BN2O7Si — CID 11735387
tert-butyl N-[(2R)-1-[[(1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-[4-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 11735387) has the molecular formula C45H59BN2O7Si and a molecular weight of 778.87 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-[[(1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-[4-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-[[(1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-[4-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 11735387 |
| Molecular Formula | C45H59BN2O7Si |
| Molecular Weight | 778.87 g/mol |
| Exact Mass | 778.42 |
| IUPAC Name | tert-butyl N-[(2R)-1-[[(1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-[4-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | COc1ccc([C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)NC(=O)[C@@H](Cc2ccccc2)NC(=O)OC(C)(C)C)cc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C45H59BN2O7Si/c1-42(2,3)53-41(50)48-37(29-32-21-15-12-16-22-32)40(49)47-38(33-27-28-39(51-11)36(30-33)46-54-44(7,8)45(9,10)55-46)31-52-56(43(4,5)6,34-23-17-13-18-24-34)35-25-19-14-20-26-35/h12-28,30,37-38H,29,31H2,1-11H3,(H,47,49)(H,48,50)/t37-,38+/m1/s1 |
| InChIKey | YULXNGMKWNESGG-AMAPPZPBSA-N |
| XLogP | 6.86 |
| TPSA | 104.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.87 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|