C31H34O3Si — CID 69313641
[3-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-phenylmethoxyphenyl]methanol (PubChem CID 69313641) has the molecular formula C31H34O3Si and a molecular weight of 482.70 g/mol. Its IUPAC name is [3-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-phenylmethoxyphenyl]methanol.
| Compound Name | [3-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-phenylmethoxyphenyl]methanol |
|---|---|
| PubChem CID | 69313641 |
| Molecular Formula | C31H34O3Si |
| Molecular Weight | 482.70 g/mol |
| Exact Mass | 482.23 |
| IUPAC Name | [3-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-phenylmethoxyphenyl]methanol |
| SMILES | CC(C)(C)[Si](OCc1cc(CO)cc(OCc2ccccc2)c1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H34O3Si/c1-31(2,3)35(29-15-9-5-10-16-29,30-17-11-6-12-18-30)34-24-27-19-26(22-32)20-28(21-27)33-23-25-13-7-4-8-14-25/h4-21,32H,22-24H2,1-3H3 |
| InChIKey | LDOVSBOGZLOTHZ-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.70 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|