C26H32O2Si — CID 54762237
[4-[(2S)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]phenyl]methanol (PubChem CID 54762237) has the molecular formula C26H32O2Si and a molecular weight of 404.63 g/mol. Its IUPAC name is [4-[(2S)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]phenyl]methanol.
| Compound Name | [4-[(2S)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]phenyl]methanol |
|---|---|
| PubChem CID | 54762237 |
| Molecular Formula | C26H32O2Si |
| Molecular Weight | 404.63 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | [4-[(2S)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]phenyl]methanol |
| SMILES | C[C@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)c1ccc(CO)cc1 |
| InChI | InChI=1S/C26H32O2Si/c1-21(23-17-15-22(19-27)16-18-23)20-28-29(26(2,3)4,24-11-7-5-8-12-24)25-13-9-6-10-14-25/h5-18,21,27H,19-20H2,1-4H3/t21-/m1/s1 |
| InChIKey | VOYFORCSDMYNLY-OAQYLSRUSA-N |
| XLogP | 4.86 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.63 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|