C32H37NO2Si — CID 153411901
N-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-N-methyl-3-phenylmethoxyaniline (PubChem CID 153411901) has the molecular formula C32H37NO2Si and a molecular weight of 495.74 g/mol. Its IUPAC name is N-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-N-methyl-3-phenylmethoxyaniline.
| Compound Name | N-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-N-methyl-3-phenylmethoxyaniline |
|---|---|
| PubChem CID | 153411901 |
| Molecular Formula | C32H37NO2Si |
| Molecular Weight | 495.74 g/mol |
| Exact Mass | 495.26 |
| IUPAC Name | N-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-N-methyl-3-phenylmethoxyaniline |
| SMILES | CN(CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)c1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C32H37NO2Si/c1-32(2,3)36(30-19-10-6-11-20-30,31-21-12-7-13-22-31)35-24-23-33(4)28-17-14-18-29(25-28)34-26-27-15-8-5-9-16-27/h5-22,25H,23-24,26H2,1-4H3 |
| InChIKey | GMXQUNLFLPMLSH-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.74 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|