C29H37NO3SSi — CID 123610665
5-[2-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl-methylamino]-2-phenylmethoxyphenyl]ethenyl]thiophene-2-carbaldehyde (PubChem CID 123610665) has the molecular formula C29H37NO3SSi and a molecular weight of 507.77 g/mol. Its IUPAC name is 5-[2-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl-methylamino]-2-phenylmethoxyphenyl]ethenyl]thiophene-2-carbaldehyde.
| Compound Name | 5-[2-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl-methylamino]-2-phenylmethoxyphenyl]ethenyl]thiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 123610665 |
| Molecular Formula | C29H37NO3SSi |
| Molecular Weight | 507.77 g/mol |
| Exact Mass | 507.23 |
| IUPAC Name | 5-[2-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl-methylamino]-2-phenylmethoxyphenyl]ethenyl]thiophene-2-carbaldehyde |
| SMILES | CN(CCO[Si](C)(C)C(C)(C)C)c1ccc(C=Cc2ccc(C=O)s2)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C29H37NO3SSi/c1-29(2,3)35(5,6)33-19-18-30(4)25-14-12-24(13-15-26-16-17-27(21-31)34-26)28(20-25)32-22-23-10-8-7-9-11-23/h7-17,20-21H,18-19,22H2,1-6H3 |
| InChIKey | GVLGLFOEEQXKOE-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.77 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|