C43H48F3NO3S — CID 88967914
4-[N-butyl-4-[(E)-2-[5-[(1E,3Z)-4,6-dimethyl-3-phenyl-5-(trifluoromethoxy)hepta-1,3,5-trienyl]thiophen-2-yl]ethenyl]-3-phenylmethoxyanilino]butan-1-ol (PubChem CID 88967914) has the molecular formula C43H48F3NO3S and a molecular weight of 715.92 g/mol. Its IUPAC name is 4-[N-butyl-4-[(E)-2-[5-[(1E,3Z)-4,6-dimethyl-3-phenyl-5-(trifluoromethoxy)hepta-1,3,5-trienyl]thiophen-2-yl]ethenyl]-3-phenylmethoxyanilino]butan-1-ol.
| Compound Name | 4-[N-butyl-4-[(E)-2-[5-[(1E,3Z)-4,6-dimethyl-3-phenyl-5-(trifluoromethoxy)hepta-1,3,5-trienyl]thiophen-2-yl]ethenyl]-3-phenylmethoxyanilino]butan-1-ol |
|---|---|
| PubChem CID | 88967914 |
| Molecular Formula | C43H48F3NO3S |
| Molecular Weight | 715.92 g/mol |
| Exact Mass | 715.33 |
| IUPAC Name | 4-[N-butyl-4-[(E)-2-[5-[(1E,3Z)-4,6-dimethyl-3-phenyl-5-(trifluoromethoxy)hepta-1,3,5-trienyl]thiophen-2-yl]ethenyl]-3-phenylmethoxyanilino]butan-1-ol |
| SMILES | CCCCN(CCCCO)c1ccc(/C=C/c2ccc(/C=C/C(=C(\C)C(OC(F)(F)F)=C(C)C)c3ccccc3)s2)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C43H48F3NO3S/c1-5-6-27-47(28-13-14-29-48)37-21-19-36(41(30-37)49-31-34-15-9-7-10-16-34)20-22-38-23-24-39(51-38)25-26-40(35-17-11-8-12-18-35)33(4)42(32(2)3)50-43(44,45)46/h7-12,15-26,30,48H,5-6,13-14,27-29,31H2,1-4H3/b22-20+,26-25+,40-33- |
| InChIKey | WKRHPIMNBCPTDR-ZIPZVSRKSA-N |
| XLogP | 12.19 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.92 |
| LogP ≤ 5 | 12.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|