C37H45NO2SSi — CID 86667556
5-[2-[2-[tert-butyl(diphenyl)silyl]oxy-4-(dibutylamino)phenyl]ethenyl]thiophene-2-carbaldehyde (PubChem CID 86667556) has the molecular formula C37H45NO2SSi and a molecular weight of 595.93 g/mol. Its IUPAC name is 5-[2-[2-[tert-butyl(diphenyl)silyl]oxy-4-(dibutylamino)phenyl]ethenyl]thiophene-2-carbaldehyde.
| Compound Name | 5-[2-[2-[tert-butyl(diphenyl)silyl]oxy-4-(dibutylamino)phenyl]ethenyl]thiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 86667556 |
| Molecular Formula | C37H45NO2SSi |
| Molecular Weight | 595.93 g/mol |
| Exact Mass | 595.29 |
| IUPAC Name | 5-[2-[2-[tert-butyl(diphenyl)silyl]oxy-4-(dibutylamino)phenyl]ethenyl]thiophene-2-carbaldehyde |
| SMILES | CCCCN(CCCC)c1ccc(C=Cc2ccc(C=O)s2)c(O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)c1 |
| InChI | InChI=1S/C37H45NO2SSi/c1-6-8-26-38(27-9-7-2)31-22-20-30(21-23-32-24-25-33(29-39)41-32)36(28-31)40-42(37(3,4)5,34-16-12-10-13-17-34)35-18-14-11-15-19-35/h10-25,28-29H,6-9,26-27H2,1-5H3 |
| InChIKey | BHBASVVNOGPRFQ-UHFFFAOYSA-N |
| XLogP | 9.08 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.93 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|