C39H42O3Si2 — CID 44598255
2,4-bis[[tert-butyl(diphenyl)silyl]oxy]benzaldehyde (PubChem CID 44598255) has the molecular formula C39H42O3Si2 and a molecular weight of 614.93 g/mol. Its IUPAC name is 2,4-bis[[tert-butyl(diphenyl)silyl]oxy]benzaldehyde.
| Compound Name | 2,4-bis[[tert-butyl(diphenyl)silyl]oxy]benzaldehyde |
|---|---|
| PubChem CID | 44598255 |
| Molecular Formula | C39H42O3Si2 |
| Molecular Weight | 614.93 g/mol |
| Exact Mass | 614.27 |
| IUPAC Name | 2,4-bis[[tert-butyl(diphenyl)silyl]oxy]benzaldehyde |
| SMILES | CC(C)(C)[Si](Oc1ccc(C=O)c(O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)c1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C39H42O3Si2/c1-38(2,3)43(33-19-11-7-12-20-33,34-21-13-8-14-22-34)41-32-28-27-31(30-40)37(29-32)42-44(39(4,5)6,35-23-15-9-16-24-35)36-25-17-10-18-26-36/h7-30H,1-6H3 |
| InChIKey | WSPGRMWYMUGDIF-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.93 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|