C23H25NO3Si — CID 177114927
5-[tert-butyl(diphenyl)silyl]oxy-2-hydroxybenzamide (PubChem CID 177114927) has the molecular formula C23H25NO3Si and a molecular weight of 391.54 g/mol. Its IUPAC name is 5-[tert-butyl(diphenyl)silyl]oxy-2-hydroxybenzamide.
| Compound Name | 5-[tert-butyl(diphenyl)silyl]oxy-2-hydroxybenzamide |
|---|---|
| PubChem CID | 177114927 |
| Molecular Formula | C23H25NO3Si |
| Molecular Weight | 391.54 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 5-[tert-butyl(diphenyl)silyl]oxy-2-hydroxybenzamide |
| SMILES | CC(C)(C)[Si](Oc1ccc(O)c(C(N)=O)c1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H25NO3Si/c1-23(2,3)28(18-10-6-4-7-11-18,19-12-8-5-9-13-19)27-17-14-15-21(25)20(16-17)22(24)26/h4-16,25H,1-3H3,(H2,24,26) |
| InChIKey | VFVZTNHXLZGQOJ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.54 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|