C25H28O4Si — CID 57443556
methyl 2-[3-[tert-butyl(diphenyl)silyl]oxy-5-hydroxyphenyl]acetate (PubChem CID 57443556) has the molecular formula C25H28O4Si and a molecular weight of 420.58 g/mol. Its IUPAC name is methyl 2-[3-[tert-butyl(diphenyl)silyl]oxy-5-hydroxyphenyl]acetate.
| Compound Name | methyl 2-[3-[tert-butyl(diphenyl)silyl]oxy-5-hydroxyphenyl]acetate |
|---|---|
| PubChem CID | 57443556 |
| Molecular Formula | C25H28O4Si |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | methyl 2-[3-[tert-butyl(diphenyl)silyl]oxy-5-hydroxyphenyl]acetate |
| SMILES | COC(=O)Cc1cc(O)cc(O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)c1 |
| InChI | InChI=1S/C25H28O4Si/c1-25(2,3)30(22-11-7-5-8-12-22,23-13-9-6-10-14-23)29-21-16-19(15-20(26)18-21)17-24(27)28-4/h5-16,18,26H,17H2,1-4H3 |
| InChIKey | VDEDNZUFNRKOBP-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|