C21H38O4Si2 — CID 11258393
methyl 2-[3,5-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]acetate (PubChem CID 11258393) has the molecular formula C21H38O4Si2 and a molecular weight of 410.70 g/mol. Its IUPAC name is methyl 2-[3,5-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]acetate.
| Compound Name | methyl 2-[3,5-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]acetate |
|---|---|
| PubChem CID | 11258393 |
| Molecular Formula | C21H38O4Si2 |
| Molecular Weight | 410.70 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | methyl 2-[3,5-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]acetate |
| SMILES | COC(=O)Cc1cc(O[Si](C)(C)C(C)(C)C)cc(O[Si](C)(C)C(C)(C)C)c1 |
| InChI | InChI=1S/C21H38O4Si2/c1-20(2,3)26(8,9)24-17-12-16(14-19(22)23-7)13-18(15-17)25-27(10,11)21(4,5)6/h12-13,15H,14H2,1-11H3 |
| InChIKey | FJVZETLIUDUPMP-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.70 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|