C16H27NO3Si — CID 59524403
methyl 2-[[3-[tert-butyl(dimethyl)silyl]oxyphenyl]methylamino]acetate (PubChem CID 59524403) has the molecular formula C16H27NO3Si and a molecular weight of 309.48 g/mol. Its IUPAC name is methyl 2-[[3-[tert-butyl(dimethyl)silyl]oxyphenyl]methylamino]acetate.
| Compound Name | methyl 2-[[3-[tert-butyl(dimethyl)silyl]oxyphenyl]methylamino]acetate |
|---|---|
| PubChem CID | 59524403 |
| Molecular Formula | C16H27NO3Si |
| Molecular Weight | 309.48 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | methyl 2-[[3-[tert-butyl(dimethyl)silyl]oxyphenyl]methylamino]acetate |
| SMILES | COC(=O)CNCc1cccc(O[Si](C)(C)C(C)(C)C)c1 |
| InChI | InChI=1S/C16H27NO3Si/c1-16(2,3)21(5,6)20-14-9-7-8-13(10-14)11-17-12-15(18)19-4/h7-10,17H,11-12H2,1-6H3 |
| InChIKey | MCTPDJYXXIPKNA-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.48 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|