C22H28F3NO3SSi — CID 123379153
N-[[3-[tert-butyl(dimethyl)silyl]oxyphenyl]methyl]-5-propanoyl-4-(trifluoromethyl)thiophene-2-carboxamide (PubChem CID 123379153) has the molecular formula C22H28F3NO3SSi and a molecular weight of 471.62 g/mol. Its IUPAC name is N-[[3-[tert-butyl(dimethyl)silyl]oxyphenyl]methyl]-5-propanoyl-4-(trifluoromethyl)thiophene-2-carboxamide.
| Compound Name | N-[[3-[tert-butyl(dimethyl)silyl]oxyphenyl]methyl]-5-propanoyl-4-(trifluoromethyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 123379153 |
| Molecular Formula | C22H28F3NO3SSi |
| Molecular Weight | 471.62 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | N-[[3-[tert-butyl(dimethyl)silyl]oxyphenyl]methyl]-5-propanoyl-4-(trifluoromethyl)thiophene-2-carboxamide |
| SMILES | CCC(=O)c1sc(C(=O)NCc2cccc(O[Si](C)(C)C(C)(C)C)c2)cc1C(F)(F)F |
| InChI | InChI=1S/C22H28F3NO3SSi/c1-7-17(27)19-16(22(23,24)25)12-18(30-19)20(28)26-13-14-9-8-10-15(11-14)29-31(5,6)21(2,3)4/h8-12H,7,13H2,1-6H3,(H,26,28) |
| InChIKey | CDGHYRNXJSQRIA-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.62 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|