C18H31NO4Si — CID 59524397
methyl 2-[[3-[tert-butyl(dimethyl)silyl]oxyphenyl]methylamino]-3-hydroxy-2-methylpropanoate (PubChem CID 59524397) has the molecular formula C18H31NO4Si and a molecular weight of 353.54 g/mol. Its IUPAC name is methyl 2-[[3-[tert-butyl(dimethyl)silyl]oxyphenyl]methylamino]-3-hydroxy-2-methylpropanoate.
| Compound Name | methyl 2-[[3-[tert-butyl(dimethyl)silyl]oxyphenyl]methylamino]-3-hydroxy-2-methylpropanoate |
|---|---|
| PubChem CID | 59524397 |
| Molecular Formula | C18H31NO4Si |
| Molecular Weight | 353.54 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | methyl 2-[[3-[tert-butyl(dimethyl)silyl]oxyphenyl]methylamino]-3-hydroxy-2-methylpropanoate |
| SMILES | COC(=O)C(C)(CO)NCc1cccc(O[Si](C)(C)C(C)(C)C)c1 |
| InChI | InChI=1S/C18H31NO4Si/c1-17(2,3)24(6,7)23-15-10-8-9-14(11-15)12-19-18(4,13-20)16(21)22-5/h8-11,19-20H,12-13H2,1-7H3 |
| InChIKey | NYDSOZJDVCYEOV-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.54 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|