C14H23BrOSi — CID 159025466
(3-bromo-5-ethylphenoxy)-tert-butyl-dimethylsilane (PubChem CID 159025466) has the molecular formula C14H23BrOSi and a molecular weight of 315.33 g/mol. Its IUPAC name is (3-bromo-5-ethylphenoxy)-tert-butyl-dimethylsilane.
| Compound Name | (3-bromo-5-ethylphenoxy)-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 159025466 |
| Molecular Formula | C14H23BrOSi |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | (3-bromo-5-ethylphenoxy)-tert-butyl-dimethylsilane |
| SMILES | CCc1cc(Br)cc(O[Si](C)(C)C(C)(C)C)c1 |
| InChI | InChI=1S/C14H23BrOSi/c1-7-11-8-12(15)10-13(9-11)16-17(5,6)14(2,3)4/h8-10H,7H2,1-6H3 |
| InChIKey | YXBJJEPSJCIZCX-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|