C34H40O11Si — CID 10963330
dimethyl 5-[[3-[[3,5-bis(methoxycarbonyl)phenoxy]methyl]-5-[tert-butyl(dimethyl)silyl]oxyphenyl]methoxy]benzene-1,3-dicarboxylate (PubChem CID 10963330) has the molecular formula C34H40O11Si and a molecular weight of 652.77 g/mol. Its IUPAC name is dimethyl 5-[[3-[[3,5-bis(methoxycarbonyl)phenoxy]methyl]-5-[tert-butyl(dimethyl)silyl]oxyphenyl]methoxy]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[[3-[[3,5-bis(methoxycarbonyl)phenoxy]methyl]-5-[tert-butyl(dimethyl)silyl]oxyphenyl]methoxy]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 10963330 |
| Molecular Formula | C34H40O11Si |
| Molecular Weight | 652.77 g/mol |
| Exact Mass | 652.23 |
| IUPAC Name | dimethyl 5-[[3-[[3,5-bis(methoxycarbonyl)phenoxy]methyl]-5-[tert-butyl(dimethyl)silyl]oxyphenyl]methoxy]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(OCc2cc(COc3cc(C(=O)OC)cc(C(=O)OC)c3)cc(O[Si](C)(C)C(C)(C)C)c2)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C34H40O11Si/c1-34(2,3)46(8,9)45-29-11-21(19-43-27-15-23(30(35)39-4)13-24(16-27)31(36)40-5)10-22(12-29)20-44-28-17-25(32(37)41-6)14-26(18-28)33(38)42-7/h10-18H,19-20H2,1-9H3 |
| InChIKey | XOJKBSOSCRTBEC-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.77 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|