methyl 3,5-bis[(4-tert-butylphenyl)methoxy]benzoate

C30H36O4 — CID 135035006

IUPACmethyl 3,5-bis[(4-tert-butylphenyl)methoxy]benzoate
SMILESCOC(=O)c1cc(OCc2ccc(C(C)(C)C)cc2)cc(OCc2ccc(C(C)(C)C)cc2)c1
InChIInChI=1S/C30H36O4/c1-29(2,3)24-12-8-21(9-13-24)19-33-26-16-23(28(31)32-7)17-27(18-26)34-20-22-10-14-25(15-11-22)30(4,5)6/h8-18H,19-20H2,1-7H3
InChIKeyIQLJSQOSMOSEJO-UHFFFAOYSA-N
MW460.61 g/mol
LogP7.23
Rot. Bonds7

About methyl 3,5-bis[(4-tert-butylphenyl)methoxy]benzoate

methyl 3,5-bis[(4-tert-butylphenyl)methoxy]benzoate (PubChem CID 135035006) has the molecular formula C30H36O4 and a molecular weight of 460.61 g/mol. Its IUPAC name is methyl 3,5-bis[(4-tert-butylphenyl)methoxy]benzoate.

Molecular Properties

Compound Namemethyl 3,5-bis[(4-tert-butylphenyl)methoxy]benzoate
PubChem CID135035006
Molecular FormulaC30H36O4
Molecular Weight460.61 g/mol
Exact Mass460.26
IUPAC Namemethyl 3,5-bis[(4-tert-butylphenyl)methoxy]benzoate
SMILESCOC(=O)c1cc(OCc2ccc(C(C)(C)C)cc2)cc(OCc2ccc(C(C)(C)C)cc2)c1
InChIInChI=1S/C30H36O4/c1-29(2,3)24-12-8-21(9-13-24)19-33-26-16-23(28(31)32-7)17-27(18-26)34-20-22-10-14-25(15-11-22)30(4,5)6/h8-18H,19-20H2,1-7H3
InChIKeyIQLJSQOSMOSEJO-UHFFFAOYSA-N
XLogP7.23
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms34
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500460.61
LogP ≤ 57.23
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 3,5-bis[(4-tert-butylphenyl)methoxy]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3,5-bis[(4-tert-butylphenyl)methoxy]benzoate?
The IUPAC name of methyl 3,5-bis[(4-tert-butylphenyl)methoxy]benzoate (CID 135035006) is methyl 3,5-bis[(4-tert-butylphenyl)methoxy]benzoate.
What is the SMILES notation for methyl 3,5-bis[(4-tert-butylphenyl)methoxy]benzoate?
The canonical SMILES for methyl 3,5-bis[(4-tert-butylphenyl)methoxy]benzoate is COC(=O)c1cc(OCc2ccc(C(C)(C)C)cc2)cc(OCc2ccc(C(C)(C)C)cc2)c1.
What is the InChIKey of methyl 3,5-bis[(4-tert-butylphenyl)methoxy]benzoate?
The InChIKey is IQLJSQOSMOSEJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H36O4/c1-29(2,3)24-12-8-21(9-13-24)19-33-26-16-23(28(31)32-7)17-27(18-26)34-20-22-10-14-25(15-11-22)30(4,5)6/h8-18H,19-20H2,1-7H3.
What are the key properties of methyl 3,5-bis[(4-tert-butylphenyl)methoxy]benzoate?
methyl 3,5-bis[(4-tert-butylphenyl)methoxy]benzoate has a molecular weight of 460.61 g/mol, XLogP of 7.23, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3,5-bis[(4-tert-butylphenyl)methoxy]benzoate is sourced from PubChem (CID 135035006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).