C30H36O4 — CID 135035006
methyl 3,5-bis[(4-tert-butylphenyl)methoxy]benzoate (PubChem CID 135035006) has the molecular formula C30H36O4 and a molecular weight of 460.61 g/mol. Its IUPAC name is methyl 3,5-bis[(4-tert-butylphenyl)methoxy]benzoate.
| Compound Name | methyl 3,5-bis[(4-tert-butylphenyl)methoxy]benzoate |
|---|---|
| PubChem CID | 135035006 |
| Molecular Formula | C30H36O4 |
| Molecular Weight | 460.61 g/mol |
| Exact Mass | 460.26 |
| IUPAC Name | methyl 3,5-bis[(4-tert-butylphenyl)methoxy]benzoate |
| SMILES | COC(=O)c1cc(OCc2ccc(C(C)(C)C)cc2)cc(OCc2ccc(C(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C30H36O4/c1-29(2,3)24-12-8-21(9-13-24)19-33-26-16-23(28(31)32-7)17-27(18-26)34-20-22-10-14-25(15-11-22)30(4,5)6/h8-18H,19-20H2,1-7H3 |
| InChIKey | IQLJSQOSMOSEJO-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.61 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |