C19H35BrO3Si2 — CID 169448639
[2-bromo-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]methanol (PubChem CID 169448639) has the molecular formula C19H35BrO3Si2 and a molecular weight of 447.56 g/mol. Its IUPAC name is [2-bromo-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]methanol.
| Compound Name | [2-bromo-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]methanol |
|---|---|
| PubChem CID | 169448639 |
| Molecular Formula | C19H35BrO3Si2 |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | [2-bromo-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]methanol |
| SMILES | CC(C)(C)[Si](C)(C)Oc1cc(CO)c(Br)c(O[Si](C)(C)C(C)(C)C)c1 |
| InChI | InChI=1S/C19H35BrO3Si2/c1-18(2,3)24(7,8)22-15-11-14(13-21)17(20)16(12-15)23-25(9,10)19(4,5)6/h11-12,21H,13H2,1-10H3 |
| InChIKey | KDLPLDCKOJRSEO-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|