C21H30O2Si — CID 67250414
[2-[tert-butyl(dimethyl)silyl]oxy-5-(2,6-dimethylphenyl)phenyl]methanol (PubChem CID 67250414) has the molecular formula C21H30O2Si and a molecular weight of 342.56 g/mol. Its IUPAC name is [2-[tert-butyl(dimethyl)silyl]oxy-5-(2,6-dimethylphenyl)phenyl]methanol.
| Compound Name | [2-[tert-butyl(dimethyl)silyl]oxy-5-(2,6-dimethylphenyl)phenyl]methanol |
|---|---|
| PubChem CID | 67250414 |
| Molecular Formula | C21H30O2Si |
| Molecular Weight | 342.56 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | [2-[tert-butyl(dimethyl)silyl]oxy-5-(2,6-dimethylphenyl)phenyl]methanol |
| SMILES | Cc1cccc(C)c1-c1ccc(O[Si](C)(C)C(C)(C)C)c(CO)c1 |
| InChI | InChI=1S/C21H30O2Si/c1-15-9-8-10-16(2)20(15)17-11-12-19(18(13-17)14-22)23-24(6,7)21(3,4)5/h8-13,22H,14H2,1-7H3 |
| InChIKey | KGFNZSVGQPQDMP-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.56 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|