C22H30O5Si — CID 159123210
[3-[tert-butyl(dimethyl)silyl]oxy-2-methylphenyl]methyl 4-hydroxy-3-(hydroxymethyl)benzoate (PubChem CID 159123210) has the molecular formula C22H30O5Si and a molecular weight of 402.56 g/mol. Its IUPAC name is [3-[tert-butyl(dimethyl)silyl]oxy-2-methylphenyl]methyl 4-hydroxy-3-(hydroxymethyl)benzoate.
| Compound Name | [3-[tert-butyl(dimethyl)silyl]oxy-2-methylphenyl]methyl 4-hydroxy-3-(hydroxymethyl)benzoate |
|---|---|
| PubChem CID | 159123210 |
| Molecular Formula | C22H30O5Si |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | [3-[tert-butyl(dimethyl)silyl]oxy-2-methylphenyl]methyl 4-hydroxy-3-(hydroxymethyl)benzoate |
| SMILES | Cc1c(COC(=O)c2ccc(O)c(CO)c2)cccc1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H30O5Si/c1-15-17(8-7-9-20(15)27-28(5,6)22(2,3)4)14-26-21(25)16-10-11-19(24)18(12-16)13-23/h7-12,23-24H,13-14H2,1-6H3 |
| InChIKey | CTZWGTYJMPAASE-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|