About benzoyloxymethyl 3-tert-butyl-4-[tert-butyl(dimethyl)silyl]oxybenzoate
benzoyloxymethyl 3-tert-butyl-4-[tert-butyl(dimethyl)silyl]oxybenzoate (PubChem CID 67706731) has the molecular formula C25H34O5Si
and a molecular weight of 442.63 g/mol. Its IUPAC name is benzoyloxymethyl 3-tert-butyl-4-[tert-butyl(dimethyl)silyl]oxybenzoate.
Molecular Properties
| Compound Name | benzoyloxymethyl 3-tert-butyl-4-[tert-butyl(dimethyl)silyl]oxybenzoate |
| PubChem CID | 67706731 |
| Molecular Formula | C25H34O5Si |
| Molecular Weight | 442.63 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | benzoyloxymethyl 3-tert-butyl-4-[tert-butyl(dimethyl)silyl]oxybenzoate |
| SMILES | CC(C)(C)c1cc(C(=O)OCOC(=O)c2ccccc2)ccc1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H34O5Si/c1-24(2,3)20-16-19(14-15-21(20)30-31(7,8)25(4,5)6)23(27)29-17-28-22(26)18-12-10-9-11-13-18/h9-16H,17H2,1-8H3 |
| InChIKey | NGPBIOWFXYCEDH-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 442.63 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze benzoyloxymethyl 3-tert-butyl-4-[tert-butyl(dimethyl)silyl]oxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzoyloxymethyl 3-tert-butyl-4-[tert-butyl(dimethyl)silyl]oxybenzoate?
The IUPAC name of benzoyloxymethyl 3-tert-butyl-4-[tert-butyl(dimethyl)silyl]oxybenzoate (CID 67706731) is benzoyloxymethyl 3-tert-butyl-4-[tert-butyl(dimethyl)silyl]oxybenzoate.
What is the SMILES notation for benzoyloxymethyl 3-tert-butyl-4-[tert-butyl(dimethyl)silyl]oxybenzoate?
The canonical SMILES for benzoyloxymethyl 3-tert-butyl-4-[tert-butyl(dimethyl)silyl]oxybenzoate is CC(C)(C)c1cc(C(=O)OCOC(=O)c2ccccc2)ccc1O[Si](C)(C)C(C)(C)C.
What is the InChIKey of benzoyloxymethyl 3-tert-butyl-4-[tert-butyl(dimethyl)silyl]oxybenzoate?
The InChIKey is NGPBIOWFXYCEDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H34O5Si/c1-24(2,3)20-16-19(14-15-21(20)30-31(7,8)25(4,5)6)23(27)29-17-28-22(26)18-12-10-9-11-13-18/h9-16H,17H2,1-8H3.
What are the key properties of benzoyloxymethyl 3-tert-butyl-4-[tert-butyl(dimethyl)silyl]oxybenzoate?
benzoyloxymethyl 3-tert-butyl-4-[tert-butyl(dimethyl)silyl]oxybenzoate has a molecular weight of 442.63 g/mol, XLogP of 6.34, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzoyloxymethyl 3-tert-butyl-4-[tert-butyl(dimethyl)silyl]oxybenzoate is sourced from PubChem (CID 67706731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).