C20H35BrO3Si2 — CID 142730774
1-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]-2-bromoethanone (PubChem CID 142730774) has the molecular formula C20H35BrO3Si2 and a molecular weight of 459.57 g/mol. Its IUPAC name is 1-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]-2-bromoethanone.
| Compound Name | 1-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]-2-bromoethanone |
|---|---|
| PubChem CID | 142730774 |
| Molecular Formula | C20H35BrO3Si2 |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | 1-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]-2-bromoethanone |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(C(=O)CBr)cc1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H35BrO3Si2/c1-19(2,3)25(7,8)23-17-12-11-15(16(22)14-21)13-18(17)24-26(9,10)20(4,5)6/h11-13H,14H2,1-10H3 |
| InChIKey | YFAIXCGZOCCYOW-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|