C15H22F2O3Si — CID 19076715
2,2-difluoroethyl 3-[tert-butyl(dimethyl)silyl]oxybenzoate (PubChem CID 19076715) has the molecular formula C15H22F2O3Si and a molecular weight of 316.42 g/mol. Its IUPAC name is 2,2-difluoroethyl 3-[tert-butyl(dimethyl)silyl]oxybenzoate.
| Compound Name | 2,2-difluoroethyl 3-[tert-butyl(dimethyl)silyl]oxybenzoate |
|---|---|
| PubChem CID | 19076715 |
| Molecular Formula | C15H22F2O3Si |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 2,2-difluoroethyl 3-[tert-butyl(dimethyl)silyl]oxybenzoate |
| SMILES | CC(C)(C)[Si](C)(C)Oc1cccc(C(=O)OCC(F)F)c1 |
| InChI | InChI=1S/C15H22F2O3Si/c1-15(2,3)21(4,5)20-12-8-6-7-11(9-12)14(18)19-10-13(16)17/h6-9,13H,10H2,1-5H3 |
| InChIKey | YAOIFFWFNXKFGX-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|