C18H26Br2OSi — CID 87503870
tert-butyl-[3-[(3Z)-6,6-dibromohexa-3,5-dien-3-yl]phenoxy]-dimethylsilane (PubChem CID 87503870) has the molecular formula C18H26Br2OSi and a molecular weight of 446.30 g/mol. Its IUPAC name is tert-butyl-[3-[(3Z)-6,6-dibromohexa-3,5-dien-3-yl]phenoxy]-dimethylsilane.
| Compound Name | tert-butyl-[3-[(3Z)-6,6-dibromohexa-3,5-dien-3-yl]phenoxy]-dimethylsilane |
|---|---|
| PubChem CID | 87503870 |
| Molecular Formula | C18H26Br2OSi |
| Molecular Weight | 446.30 g/mol |
| Exact Mass | 444.01 |
| IUPAC Name | tert-butyl-[3-[(3Z)-6,6-dibromohexa-3,5-dien-3-yl]phenoxy]-dimethylsilane |
| SMILES | CC/C(=C/C=C(Br)Br)c1cccc(O[Si](C)(C)C(C)(C)C)c1 |
| InChI | InChI=1S/C18H26Br2OSi/c1-7-14(11-12-17(19)20)15-9-8-10-16(13-15)21-22(5,6)18(2,3)4/h8-13H,7H2,1-6H3/b14-11- |
| InChIKey | FAZFUKWGXDAINV-KAMYIIQDSA-N |
| XLogP | 7.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.30 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|