C32H48O3Si2 — CID 87503923
tert-butyl-[2-[tert-butyl(dimethyl)silyl]oxy-4-[1-[3-[(E)-hex-3-en-5-yn-3-yl]phenoxy]ethyl]phenoxy]-dimethylsilane (PubChem CID 87503923) has the molecular formula C32H48O3Si2 and a molecular weight of 536.91 g/mol. Its IUPAC name is tert-butyl-[2-[tert-butyl(dimethyl)silyl]oxy-4-[1-[3-[(E)-hex-3-en-5-yn-3-yl]phenoxy]ethyl]phenoxy]-dimethylsilane.
| Compound Name | tert-butyl-[2-[tert-butyl(dimethyl)silyl]oxy-4-[1-[3-[(E)-hex-3-en-5-yn-3-yl]phenoxy]ethyl]phenoxy]-dimethylsilane |
|---|---|
| PubChem CID | 87503923 |
| Molecular Formula | C32H48O3Si2 |
| Molecular Weight | 536.91 g/mol |
| Exact Mass | 536.31 |
| IUPAC Name | tert-butyl-[2-[tert-butyl(dimethyl)silyl]oxy-4-[1-[3-[(E)-hex-3-en-5-yn-3-yl]phenoxy]ethyl]phenoxy]-dimethylsilane |
| SMILES | C#C/C=C(\CC)c1cccc(OC(C)c2ccc(O[Si](C)(C)C(C)(C)C)c(O[Si](C)(C)C(C)(C)C)c2)c1 |
| InChI | InChI=1S/C32H48O3Si2/c1-14-17-25(15-2)27-18-16-19-28(22-27)33-24(3)26-20-21-29(34-36(10,11)31(4,5)6)30(23-26)35-37(12,13)32(7,8)9/h1,16-24H,15H2,2-13H3/b25-17+ |
| InChIKey | MNTNFGVAIAMCCP-KOEQRZSOSA-N |
| XLogP | 10.02 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.91 |
| LogP ≤ 5 | 10.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|