C28H40N2O4Si2 — CID 67879756
3-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]-2-cyano-3-hydroxy-N-phenylprop-2-enamide (PubChem CID 67879756) has the molecular formula C28H40N2O4Si2 and a molecular weight of 524.81 g/mol. Its IUPAC name is 3-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]-2-cyano-3-hydroxy-N-phenylprop-2-enamide.
| Compound Name | 3-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]-2-cyano-3-hydroxy-N-phenylprop-2-enamide |
|---|---|
| PubChem CID | 67879756 |
| Molecular Formula | C28H40N2O4Si2 |
| Molecular Weight | 524.81 g/mol |
| Exact Mass | 524.25 |
| IUPAC Name | 3-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]-2-cyano-3-hydroxy-N-phenylprop-2-enamide |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(C(O)=C(C#N)C(=O)Nc2ccccc2)cc1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H40N2O4Si2/c1-27(2,3)35(7,8)33-23-17-16-20(18-24(23)34-36(9,10)28(4,5)6)25(31)22(19-29)26(32)30-21-14-12-11-13-15-21/h11-18,31H,1-10H3,(H,30,32) |
| InChIKey | BROUZSMXPRYKDQ-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 91.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.81 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|