C23H30N2O2Si — CID 102441155
4-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-N-(2-phenylethyl)benzenecarboximidoyl cyanide (PubChem CID 102441155) has the molecular formula C23H30N2O2Si and a molecular weight of 394.59 g/mol. Its IUPAC name is 4-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-N-(2-phenylethyl)benzenecarboximidoyl cyanide.
| Compound Name | 4-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-N-(2-phenylethyl)benzenecarboximidoyl cyanide |
|---|---|
| PubChem CID | 102441155 |
| Molecular Formula | C23H30N2O2Si |
| Molecular Weight | 394.59 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | 4-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-N-(2-phenylethyl)benzenecarboximidoyl cyanide |
| SMILES | COc1cc(/C(C#N)=N/CCc2ccccc2)ccc1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H30N2O2Si/c1-23(2,3)28(5,6)27-21-13-12-19(16-22(21)26-4)20(17-24)25-15-14-18-10-8-7-9-11-18/h7-13,16H,14-15H2,1-6H3/b25-20+ |
| InChIKey | DDMVKGURVPZVSV-LKUDQCMESA-N |
| XLogP | 5.63 |
| TPSA | 54.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.59 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|