C33H45NO3SSi — CID 150926632
O-[1-[4-[tert-butyl(dimethyl)silyl]oxy-3-methoxyphenyl]-4-phenylpentan-3-yl] N-(2-phenylethyl)carbamothioate (PubChem CID 150926632) has the molecular formula C33H45NO3SSi and a molecular weight of 563.88 g/mol. Its IUPAC name is O-[1-[4-[tert-butyl(dimethyl)silyl]oxy-3-methoxyphenyl]-4-phenylpentan-3-yl] N-(2-phenylethyl)carbamothioate.
| Compound Name | O-[1-[4-[tert-butyl(dimethyl)silyl]oxy-3-methoxyphenyl]-4-phenylpentan-3-yl] N-(2-phenylethyl)carbamothioate |
|---|---|
| PubChem CID | 150926632 |
| Molecular Formula | C33H45NO3SSi |
| Molecular Weight | 563.88 g/mol |
| Exact Mass | 563.29 |
| IUPAC Name | O-[1-[4-[tert-butyl(dimethyl)silyl]oxy-3-methoxyphenyl]-4-phenylpentan-3-yl] N-(2-phenylethyl)carbamothioate |
| SMILES | COc1cc(CCC(OC(=S)NCCc2ccccc2)C(C)c2ccccc2)ccc1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C33H45NO3SSi/c1-25(28-16-12-9-13-17-28)29(36-32(38)34-23-22-26-14-10-8-11-15-26)20-18-27-19-21-30(31(24-27)35-5)37-39(6,7)33(2,3)4/h8-17,19,21,24-25,29H,18,20,22-23H2,1-7H3,(H,34,38) |
| InChIKey | LFDQUBXEKJZZQE-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.88 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|