C29H44O2SSi — CID 86590088
8-[4-[tert-butyl(dimethyl)silyl]oxy-3-methoxyphenyl]-6-ethyl-1-phenyloctane-4-thione (PubChem CID 86590088) has the molecular formula C29H44O2SSi and a molecular weight of 484.82 g/mol. Its IUPAC name is 8-[4-[tert-butyl(dimethyl)silyl]oxy-3-methoxyphenyl]-6-ethyl-1-phenyloctane-4-thione.
| Compound Name | 8-[4-[tert-butyl(dimethyl)silyl]oxy-3-methoxyphenyl]-6-ethyl-1-phenyloctane-4-thione |
|---|---|
| PubChem CID | 86590088 |
| Molecular Formula | C29H44O2SSi |
| Molecular Weight | 484.82 g/mol |
| Exact Mass | 484.28 |
| IUPAC Name | 8-[4-[tert-butyl(dimethyl)silyl]oxy-3-methoxyphenyl]-6-ethyl-1-phenyloctane-4-thione |
| SMILES | CCC(CCc1ccc(O[Si](C)(C)C(C)(C)C)c(OC)c1)CC(=S)CCCc1ccccc1 |
| InChI | InChI=1S/C29H44O2SSi/c1-8-23(21-26(32)16-12-15-24-13-10-9-11-14-24)17-18-25-19-20-27(28(22-25)30-5)31-33(6,7)29(2,3)4/h9-11,13-14,19-20,22-23H,8,12,15-18,21H2,1-7H3 |
| InChIKey | UZMWNZHDRBPSSN-UHFFFAOYSA-N |
| XLogP | 8.82 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.82 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|