C28H42O5Si — CID 66862880
(3S)-3-[(S)-[tert-butyl(dimethyl)silyl]oxy-(3,5-dimethoxy-4-methylphenyl)methyl]-6-phenylhexanoic acid (PubChem CID 66862880) has the molecular formula C28H42O5Si and a molecular weight of 486.73 g/mol. Its IUPAC name is (3S)-3-[(S)-[tert-butyl(dimethyl)silyl]oxy-(3,5-dimethoxy-4-methylphenyl)methyl]-6-phenylhexanoic acid.
| Compound Name | (3S)-3-[(S)-[tert-butyl(dimethyl)silyl]oxy-(3,5-dimethoxy-4-methylphenyl)methyl]-6-phenylhexanoic acid |
|---|---|
| PubChem CID | 66862880 |
| Molecular Formula | C28H42O5Si |
| Molecular Weight | 486.73 g/mol |
| Exact Mass | 486.28 |
| IUPAC Name | (3S)-3-[(S)-[tert-butyl(dimethyl)silyl]oxy-(3,5-dimethoxy-4-methylphenyl)methyl]-6-phenylhexanoic acid |
| SMILES | COc1cc([C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CCCc2ccccc2)CC(=O)O)cc(OC)c1C |
| InChI | InChI=1S/C28H42O5Si/c1-20-24(31-5)17-23(18-25(20)32-6)27(33-34(7,8)28(2,3)4)22(19-26(29)30)16-12-15-21-13-10-9-11-14-21/h9-11,13-14,17-18,22,27H,12,15-16,19H2,1-8H3,(H,29,30)/t22-,27-/m0/s1 |
| InChIKey | JADJWDSAGXCLDY-CUNXSJBXSA-N |
| XLogP | 7.19 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.73 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|