C26H40O5Si — CID 169092232
(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-3-(3,5-dimethoxy-4-methylphenyl)-2-(2-phenylethoxy)propan-1-ol (PubChem CID 169092232) has the molecular formula C26H40O5Si and a molecular weight of 460.69 g/mol. Its IUPAC name is (2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-3-(3,5-dimethoxy-4-methylphenyl)-2-(2-phenylethoxy)propan-1-ol.
| Compound Name | (2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-3-(3,5-dimethoxy-4-methylphenyl)-2-(2-phenylethoxy)propan-1-ol |
|---|---|
| PubChem CID | 169092232 |
| Molecular Formula | C26H40O5Si |
| Molecular Weight | 460.69 g/mol |
| Exact Mass | 460.26 |
| IUPAC Name | (2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-3-(3,5-dimethoxy-4-methylphenyl)-2-(2-phenylethoxy)propan-1-ol |
| SMILES | COc1cc([C@@H](O[Si](C)(C)C(C)(C)C)[C@H](CO)OCCc2ccccc2)cc(OC)c1C |
| InChI | InChI=1S/C26H40O5Si/c1-19-22(28-5)16-21(17-23(19)29-6)25(31-32(7,8)26(2,3)4)24(18-27)30-15-14-20-12-10-9-11-13-20/h9-13,16-17,24-25,27H,14-15,18H2,1-8H3/t24-,25+/m0/s1 |
| InChIKey | MYZWZKYHZQYLIG-LOSJGSFVSA-N |
| XLogP | 5.70 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.69 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|