C33H49NO7Si — CID 66861609
methyl 4-[[(3S)-3-[(S)-[tert-butyl(dimethyl)silyl]oxy-(3,5-dimethoxy-4-methylphenyl)methyl]-6-phenylhexanoyl]amino]-3-oxobutanoate (PubChem CID 66861609) has the molecular formula C33H49NO7Si and a molecular weight of 599.84 g/mol. Its IUPAC name is methyl 4-[[(3S)-3-[(S)-[tert-butyl(dimethyl)silyl]oxy-(3,5-dimethoxy-4-methylphenyl)methyl]-6-phenylhexanoyl]amino]-3-oxobutanoate.
| Compound Name | methyl 4-[[(3S)-3-[(S)-[tert-butyl(dimethyl)silyl]oxy-(3,5-dimethoxy-4-methylphenyl)methyl]-6-phenylhexanoyl]amino]-3-oxobutanoate |
|---|---|
| PubChem CID | 66861609 |
| Molecular Formula | C33H49NO7Si |
| Molecular Weight | 599.84 g/mol |
| Exact Mass | 599.33 |
| IUPAC Name | methyl 4-[[(3S)-3-[(S)-[tert-butyl(dimethyl)silyl]oxy-(3,5-dimethoxy-4-methylphenyl)methyl]-6-phenylhexanoyl]amino]-3-oxobutanoate |
| SMILES | COC(=O)CC(=O)CNC(=O)C[C@H](CCCc1ccccc1)[C@H](O[Si](C)(C)C(C)(C)C)c1cc(OC)c(C)c(OC)c1 |
| InChI | InChI=1S/C33H49NO7Si/c1-23-28(38-5)18-26(19-29(23)39-6)32(41-42(8,9)33(2,3)4)25(17-13-16-24-14-11-10-12-15-24)20-30(36)34-22-27(35)21-31(37)40-7/h10-12,14-15,18-19,25,32H,13,16-17,20-22H2,1-9H3,(H,34,36)/t25-,32-/m0/s1 |
| InChIKey | ZQGLAYUALLDAEL-UKJJDJLKSA-N |
| XLogP | 6.35 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.84 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|