C27H42O4Si — CID 66862256
(2S)-2-[[tert-butyl(dimethyl)silyl]oxy-(3,5-dimethoxy-4-methylphenyl)methyl]-5-phenylpentan-1-ol (PubChem CID 66862256) has the molecular formula C27H42O4Si and a molecular weight of 458.72 g/mol. Its IUPAC name is (2S)-2-[[tert-butyl(dimethyl)silyl]oxy-(3,5-dimethoxy-4-methylphenyl)methyl]-5-phenylpentan-1-ol.
| Compound Name | (2S)-2-[[tert-butyl(dimethyl)silyl]oxy-(3,5-dimethoxy-4-methylphenyl)methyl]-5-phenylpentan-1-ol |
|---|---|
| PubChem CID | 66862256 |
| Molecular Formula | C27H42O4Si |
| Molecular Weight | 458.72 g/mol |
| Exact Mass | 458.29 |
| IUPAC Name | (2S)-2-[[tert-butyl(dimethyl)silyl]oxy-(3,5-dimethoxy-4-methylphenyl)methyl]-5-phenylpentan-1-ol |
| SMILES | COc1cc(C(O[Si](C)(C)C(C)(C)C)[C@H](CO)CCCc2ccccc2)cc(OC)c1C |
| InChI | InChI=1S/C27H42O4Si/c1-20-24(29-5)17-23(18-25(20)30-6)26(31-32(7,8)27(2,3)4)22(19-28)16-12-15-21-13-10-9-11-14-21/h9-11,13-14,17-18,22,26,28H,12,15-16,19H2,1-8H3/t22-,26?/m0/s1 |
| InChIKey | PPXVXTRQJDQFSK-CHQVSRGASA-N |
| XLogP | 6.71 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.72 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|