C16H28O2Si — CID 139246891
(2R)-2-[tert-butyl(dimethyl)silyl]oxy-4-phenylbutan-1-ol (PubChem CID 139246891) has the molecular formula C16H28O2Si and a molecular weight of 280.48 g/mol. Its IUPAC name is (2R)-2-[tert-butyl(dimethyl)silyl]oxy-4-phenylbutan-1-ol.
| Compound Name | (2R)-2-[tert-butyl(dimethyl)silyl]oxy-4-phenylbutan-1-ol |
|---|---|
| PubChem CID | 139246891 |
| Molecular Formula | C16H28O2Si |
| Molecular Weight | 280.48 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | (2R)-2-[tert-butyl(dimethyl)silyl]oxy-4-phenylbutan-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H](CO)CCc1ccccc1 |
| InChI | InChI=1S/C16H28O2Si/c1-16(2,3)19(4,5)18-15(13-17)12-11-14-9-7-6-8-10-14/h6-10,15,17H,11-13H2,1-5H3/t15-/m1/s1 |
| InChIKey | ZFYUAKXMGKISHI-OAHLLOKOSA-N |
| XLogP | 4.00 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.48 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|